C23H25NO2 — CID 100881587
(1S,9S,14S,15S)-15-phenyl-8,17-dioxa-20-azapentacyclo[7.7.4.01,20.02,7.09,14]icosa-2,4,6-triene (PubChem CID 100881587) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (1S,9S,14S,15S)-15-phenyl-8,17-dioxa-20-azapentacyclo[7.7.4.01,20.02,7.09,14]icosa-2,4,6-triene.
| Compound Name | (1S,9S,14S,15S)-15-phenyl-8,17-dioxa-20-azapentacyclo[7.7.4.01,20.02,7.09,14]icosa-2,4,6-triene |
|---|---|
| PubChem CID | 100881587 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (1S,9S,14S,15S)-15-phenyl-8,17-dioxa-20-azapentacyclo[7.7.4.01,20.02,7.09,14]icosa-2,4,6-triene |
| SMILES | c1ccc([C@H]2C[C@@]34OCCN3[C@@]3(CCCC[C@@H]23)Oc2ccccc24)cc1 |
| InChI | InChI=1S/C23H25NO2/c1-2-8-17(9-3-1)18-16-23-20-11-4-5-12-21(20)26-22(24(23)14-15-25-23)13-7-6-10-19(18)22/h1-5,8-9,11-12,18-19H,6-7,10,13-16H2/t18-,19+,22+,23+/m1/s1 |
| InChIKey | KMZWVRIIHGSMOD-FUKQBSRTSA-N |
| XLogP | 4.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |