C28H36N2O4 — CID 100882654
6-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2-[(1S,5S)-3,3,5-trimethylcyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 100882654) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 6-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2-[(1S,5S)-3,3,5-trimethylcyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2-[(1S,5S)-3,3,5-trimethylcyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 100882654 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 6-[(1R,5S)-3,3,5-trimethylcyclohexyl]-2-[(1S,5S)-3,3,5-trimethylcyclohexyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | C[C@@H]1C[C@@H](n2c(=O)c3cc4c(=O)n([C@H]5C[C@@H](C)CC(C)(C)C5)c(=O)c4cc3c2=O)CC(C)(C)C1 |
| InChI | InChI=1S/C28H36N2O4/c1-15-7-17(13-27(3,4)11-15)29-23(31)19-9-21-22(10-20(19)24(29)32)26(34)30(25(21)33)18-8-16(2)12-28(5,6)14-18/h9-10,15-18H,7-8,11-14H2,1-6H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | ZXKJKTFZHNJUTN-TVFCKZIOSA-N |
| XLogP | 4.69 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |