C7H12Br2O3S — CID 10088347
(2R,3R,5S)-3,5-bis(bromomethyl)-2-methyl-1,4-oxathiane 4,4-dioxide (PubChem CID 10088347) has the molecular formula C7H12Br2O3S and a molecular weight of 336.05 g/mol. Its IUPAC name is (2R,3R,5S)-3,5-bis(bromomethyl)-2-methyl-1,4-oxathiane 4,4-dioxide.
| Compound Name | (2R,3R,5S)-3,5-bis(bromomethyl)-2-methyl-1,4-oxathiane 4,4-dioxide |
|---|---|
| PubChem CID | 10088347 |
| Molecular Formula | C7H12Br2O3S |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 333.89 |
| IUPAC Name | (2R,3R,5S)-3,5-bis(bromomethyl)-2-methyl-1,4-oxathiane 4,4-dioxide |
| SMILES | C[C@H]1OC[C@@H](CBr)S(=O)(=O)[C@H]1CBr |
| InChI | InChI=1S/C7H12Br2O3S/c1-5-7(3-9)13(10,11)6(2-8)4-12-5/h5-7H,2-4H2,1H3/t5-,6-,7+/m1/s1 |
| InChIKey | IPKABSHBYZFTNW-QYNIQEEDSA-N |
| XLogP | 1.35 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|