About 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid
3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid (PubChem CID 10088672) has the molecular formula C18H12FNO5
and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid |
| PubChem CID | 10088672 |
| Molecular Formula | C18H12FNO5 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)c2cc(Cc3ccc(F)cc3)cnc2c1O |
| InChI | InChI=1S/C18H12FNO5/c19-11-3-1-9(2-4-11)5-10-6-12-13(17(22)23)7-14(18(24)25)16(21)15(12)20-8-10/h1-4,6-8,21H,5H2,(H,22,23)(H,24,25) |
| InChIKey | OBUGZHKTTGOCFG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid?
The IUPAC name of 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid (CID 10088672) is 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid.
What is the SMILES notation for 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid?
The canonical SMILES for 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid is O=C(O)c1cc(C(=O)O)c2cc(Cc3ccc(F)cc3)cnc2c1O.
What is the InChIKey of 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid?
The InChIKey is OBUGZHKTTGOCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FNO5/c19-11-3-1-9(2-4-11)5-10-6-12-13(17(22)23)7-14(18(24)25)16(21)15(12)20-8-10/h1-4,6-8,21H,5H2,(H,22,23)(H,24,25).
What are the key properties of 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid?
3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid has a molecular weight of 341.29 g/mol, XLogP of 3.07, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-fluorophenyl)methyl]-8-hydroxyquinoline-5,7-dicarboxylic acid is sourced from PubChem (CID 10088672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).