C23H23N3 — CID 10088709
4-[3-[2-[(2S)-2-methylpyrrolidin-1-yl]ethyl]isoquinolin-7-yl]benzonitrile (PubChem CID 10088709) has the molecular formula C23H23N3 and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-[3-[2-[(2S)-2-methylpyrrolidin-1-yl]ethyl]isoquinolin-7-yl]benzonitrile.
| Compound Name | 4-[3-[2-[(2S)-2-methylpyrrolidin-1-yl]ethyl]isoquinolin-7-yl]benzonitrile |
|---|---|
| PubChem CID | 10088709 |
| Molecular Formula | C23H23N3 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-[3-[2-[(2S)-2-methylpyrrolidin-1-yl]ethyl]isoquinolin-7-yl]benzonitrile |
| SMILES | C[C@H]1CCCN1CCc1cc2ccc(-c3ccc(C#N)cc3)cc2cn1 |
| InChI | InChI=1S/C23H23N3/c1-17-3-2-11-26(17)12-10-23-14-21-9-8-20(13-22(21)16-25-23)19-6-4-18(15-24)5-7-19/h4-9,13-14,16-17H,2-3,10-12H2,1H3/t17-/m0/s1 |
| InChIKey | JZZIBMGDYNYSSM-KRWDZBQOSA-N |
| XLogP | 4.80 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |