C17H30N2O5 — CID 10088760
1-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carboxylic acid (PubChem CID 10088760) has the molecular formula C17H30N2O5 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 10088760 |
| Molecular Formula | C17H30N2O5 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]piperidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C17H30N2O5/c1-17(2,3)24-16(23)18-10-6-4-5-9-14(20)19-11-7-8-13(12-19)15(21)22/h13H,4-12H2,1-3H3,(H,18,23)(H,21,22) |
| InChIKey | CPTKIHCWTFBMRO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|