C19H19F2N3O — CID 10088803
2-(3-aminophenyl)-4-(2,5-difluorophenyl)-N,N-dimethyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 10088803) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(3-aminophenyl)-4-(2,5-difluorophenyl)-N,N-dimethyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | 2-(3-aminophenyl)-4-(2,5-difluorophenyl)-N,N-dimethyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 10088803 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(3-aminophenyl)-4-(2,5-difluorophenyl)-N,N-dimethyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CN(C)C(=O)N1CC(c2cc(F)ccc2F)=CC1c1cccc(N)c1 |
| InChI | InChI=1S/C19H19F2N3O/c1-23(2)19(25)24-11-13(16-10-14(20)6-7-17(16)21)9-18(24)12-4-3-5-15(22)8-12/h3-10,18H,11,22H2,1-2H3 |
| InChIKey | ZXDMKFPBBFVPIL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|