C19H20N4O4 — CID 100888234
3-[(1S,3S,3aS,6aS)-2',4,6-trioxo-5-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide (PubChem CID 100888234) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 3-[(1S,3S,3aS,6aS)-2',4,6-trioxo-5-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide.
| Compound Name | 3-[(1S,3S,3aS,6aS)-2',4,6-trioxo-5-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
|---|---|
| PubChem CID | 100888234 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-[(1S,3S,3aS,6aS)-2',4,6-trioxo-5-prop-2-enylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanamide |
| SMILES | C=CCN1C(=O)[C@@H]2[C@H](CCC(N)=O)N[C@@]3(C(=O)Nc4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C19H20N4O4/c1-2-9-23-16(25)14-12(7-8-13(20)24)22-19(15(14)17(23)26)10-5-3-4-6-11(10)21-18(19)27/h2-6,12,14-15,22H,1,7-9H2,(H2,20,24)(H,21,27)/t12-,14+,15+,19+/m0/s1 |
| InChIKey | JGTYMOHQNZJJJV-DKEWWPDHSA-N |
| XLogP | -0.14 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|