C17H15NO5S — CID 10088912
(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 2,6-dimethylbenzoate (PubChem CID 10088912) has the molecular formula C17H15NO5S and a molecular weight of 345.38 g/mol. Its IUPAC name is (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 2,6-dimethylbenzoate.
| Compound Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 2,6-dimethylbenzoate |
|---|---|
| PubChem CID | 10088912 |
| Molecular Formula | C17H15NO5S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | (1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl 2,6-dimethylbenzoate |
| SMILES | Cc1cccc(C)c1C(=O)OCN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H15NO5S/c1-11-6-5-7-12(2)15(11)17(20)23-10-18-16(19)13-8-3-4-9-14(13)24(18,21)22/h3-9H,10H2,1-2H3 |
| InChIKey | ATXUOVHQRVTAQB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |