C20H27NO4 — CID 10088924
5-[3-[(2R)-2-[(1E,3E)-octa-1,3-dienyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid (PubChem CID 10088924) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is 5-[3-[(2R)-2-[(1E,3E)-octa-1,3-dienyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid.
| Compound Name | 5-[3-[(2R)-2-[(1E,3E)-octa-1,3-dienyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 10088924 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 5-[3-[(2R)-2-[(1E,3E)-octa-1,3-dienyl]-5-oxopyrrolidin-1-yl]propyl]furan-2-carboxylic acid |
| SMILES | CCCC/C=C/C=C/[C@H]1CCC(=O)N1CCCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C20H27NO4/c1-2-3-4-5-6-7-9-16-11-14-19(22)21(16)15-8-10-17-12-13-18(25-17)20(23)24/h5-7,9,12-13,16H,2-4,8,10-11,14-15H2,1H3,(H,23,24)/b6-5+,9-7+/t16-/m0/s1 |
| InChIKey | IXGYPWPBOKFSJQ-MZFSJHQTSA-N |
| XLogP | 4.20 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|