C19H21Cl2NO — CID 10089212
(2S,3S)-3-[(1R)-1-(3,5-dichlorophenyl)ethoxy]-2-phenylpiperidine (PubChem CID 10089212) has the molecular formula C19H21Cl2NO and a molecular weight of 350.29 g/mol. Its IUPAC name is (2S,3S)-3-[(1R)-1-(3,5-dichlorophenyl)ethoxy]-2-phenylpiperidine.
| Compound Name | (2S,3S)-3-[(1R)-1-(3,5-dichlorophenyl)ethoxy]-2-phenylpiperidine |
|---|---|
| PubChem CID | 10089212 |
| Molecular Formula | C19H21Cl2NO |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (2S,3S)-3-[(1R)-1-(3,5-dichlorophenyl)ethoxy]-2-phenylpiperidine |
| SMILES | C[C@@H](O[C@H]1CCCNC1c1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H21Cl2NO/c1-13(15-10-16(20)12-17(21)11-15)23-18-8-5-9-22-19(18)14-6-3-2-4-7-14/h2-4,6-7,10-13,18-19,22H,5,8-9H2,1H3/t13-,18+,19?/m1/s1 |
| InChIKey | UQTRGKPOVUCKIC-OJBAKJFDSA-N |
| XLogP | 5.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |