C18H18N4O3 — CID 100894404
2-[[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]amino]-6-nitroquinoline-4-carbonitrile (PubChem CID 100894404) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-[[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]amino]-6-nitroquinoline-4-carbonitrile.
| Compound Name | 2-[[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]amino]-6-nitroquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 100894404 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-[[(1R,5R,6R)-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl]amino]-6-nitroquinoline-4-carbonitrile |
| SMILES | CC1(C)[C@H](Nc2cc(C#N)c3cc([N+](=O)[O-])ccc3n2)[C@H]2CCO[C@H]21 |
| InChI | InChI=1S/C18H18N4O3/c1-18(2)16(12-5-6-25-17(12)18)21-15-7-10(9-19)13-8-11(22(23)24)3-4-14(13)20-15/h3-4,7-8,12,16-17H,5-6H2,1-2H3,(H,20,21)/t12-,16-,17-/m1/s1 |
| InChIKey | YAQFDPSUBLSYFB-CSMYWGQOSA-N |
| XLogP | 3.24 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|