About (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one
(E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 10089473) has the molecular formula C20H18O6
and a molecular weight of 354.36 g/mol. Its IUPAC name is (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| PubChem CID | 10089473 |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(/C=C/C(=O)c2c(O)c(OC)c3occc3c2OC)c1 |
| InChI | InChI=1S/C20H18O6/c1-23-13-6-4-5-12(11-13)7-8-15(21)16-17(22)20(25-3)19-14(9-10-26-19)18(16)24-2/h4-11,22H,1-3H3/b8-7+ |
| InChIKey | NZQFVFZKSNUANG-BQYQJAHWSA-N |
| XLogP | 4.06 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The IUPAC name of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one (CID 10089473) is (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one is COc1cccc(/C=C/C(=O)c2c(O)c(OC)c3occc3c2OC)c1.
What is the InChIKey of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
The InChIKey is NZQFVFZKSNUANG-BQYQJAHWSA-N. The full InChI is InChI=1S/C20H18O6/c1-23-13-6-4-5-12(11-13)7-8-15(21)16-17(22)20(25-3)19-14(9-10-26-19)18(16)24-2/h4-11,22H,1-3H3/b8-7+.
What are the key properties of (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one?
(E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one has a molecular weight of 354.36 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(6-hydroxy-4,7-dimethoxy-1-benzofuran-5-yl)-3-(3-methoxyphenyl)prop-2-en-1-one is sourced from PubChem (CID 10089473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).