C21H28NO2P — CID 10089710
(2S,3R)-3-diphenylphosphoryl-1-[(2R)-piperidin-2-yl]butan-2-ol (PubChem CID 10089710) has the molecular formula C21H28NO2P and a molecular weight of 357.43 g/mol. Its IUPAC name is (2S,3R)-3-diphenylphosphoryl-1-[(2R)-piperidin-2-yl]butan-2-ol.
| Compound Name | (2S,3R)-3-diphenylphosphoryl-1-[(2R)-piperidin-2-yl]butan-2-ol |
|---|---|
| PubChem CID | 10089710 |
| Molecular Formula | C21H28NO2P |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2S,3R)-3-diphenylphosphoryl-1-[(2R)-piperidin-2-yl]butan-2-ol |
| SMILES | C[C@H]([C@@H](O)C[C@H]1CCCCN1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28NO2P/c1-17(21(23)16-18-10-8-9-15-22-18)25(24,19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-7,11-14,17-18,21-23H,8-10,15-16H2,1H3/t17-,18-,21+/m1/s1 |
| InChIKey | PFCZGPGFZUYVNK-OPYAIIAOSA-N |
| XLogP | 3.28 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|