C17H24N2O2S — CID 100897569
2-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 100897569) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 2-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 100897569 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[(4aS,8aR)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-yl]-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN2CCS[C@@H]3COCC[C@H]32)cc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-13-2-4-14(5-3-13)10-18-17(20)11-19-7-9-22-16-12-21-8-6-15(16)19/h2-5,15-16H,6-12H2,1H3,(H,18,20)/t15-,16-/m1/s1 |
| InChIKey | STEOBCHBEJRURK-HZPDHXFCSA-N |
| XLogP | 1.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |