C17H30N2O3 — CID 100898647
(3R,3aS,7aR)-N-[(4-methoxyoxan-4-yl)methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide (PubChem CID 100898647) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is (3R,3aS,7aR)-N-[(4-methoxyoxan-4-yl)methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide.
| Compound Name | (3R,3aS,7aR)-N-[(4-methoxyoxan-4-yl)methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
|---|---|
| PubChem CID | 100898647 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (3R,3aS,7aR)-N-[(4-methoxyoxan-4-yl)methyl]-3-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxamide |
| SMILES | COC1(CNC(=O)N2C[C@H](C)[C@@H]3CCCC[C@H]32)CCOCC1 |
| InChI | InChI=1S/C17H30N2O3/c1-13-11-19(15-6-4-3-5-14(13)15)16(20)18-12-17(21-2)7-9-22-10-8-17/h13-15H,3-12H2,1-2H3,(H,18,20)/t13-,14-,15+/m0/s1 |
| InChIKey | KXFOWNVLUJOBQX-SOUVJXGZSA-N |
| XLogP | 2.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |