About (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide
(1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 100900016) has the molecular formula C18H32N2O2
and a molecular weight of 308.47 g/mol. Its IUPAC name is (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide |
| PubChem CID | 100900016 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | CCOCCCN1CC[C@H](NC(=O)[C@H]2CC=CCC2)[C@@H](C)C1 |
| InChI | InChI=1S/C18H32N2O2/c1-3-22-13-7-11-20-12-10-17(15(2)14-20)19-18(21)16-8-5-4-6-9-16/h4-5,15-17H,3,6-14H2,1-2H3,(H,19,21)/t15-,16-,17-/m0/s1 |
| InChIKey | OZQMYCZXBHLJAG-ULQDDVLXSA-N |
| XLogP | 2.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide?
The IUPAC name of (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide (CID 100900016) is (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide.
What is the SMILES notation for (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide?
The canonical SMILES for (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide is CCOCCCN1CC[C@H](NC(=O)[C@H]2CC=CCC2)[C@@H](C)C1.
What is the InChIKey of (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide?
The InChIKey is OZQMYCZXBHLJAG-ULQDDVLXSA-N. The full InChI is InChI=1S/C18H32N2O2/c1-3-22-13-7-11-20-12-10-17(15(2)14-20)19-18(21)16-8-5-4-6-9-16/h4-5,15-17H,3,6-14H2,1-2H3,(H,19,21)/t15-,16-,17-/m0/s1.
What are the key properties of (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide?
(1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide has a molecular weight of 308.47 g/mol, XLogP of 2.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N-[(3S,4S)-1-(3-ethoxypropyl)-3-methylpiperidin-4-yl]cyclohex-3-ene-1-carboxamide is sourced from PubChem (CID 100900016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).