C14H17N3O — CID 100900398
2-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]pyridine-3-carbonitrile (PubChem CID 100900398) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]pyridine-3-carbonitrile.
| Compound Name | 2-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 100900398 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 2-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1cccnc1N[C@@H]1CCC[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C14H17N3O/c15-9-10-3-2-7-16-14(10)17-12-4-1-5-13-11(12)6-8-18-13/h2-3,7,11-13H,1,4-6,8H2,(H,16,17)/t11-,12+,13+/m0/s1 |
| InChIKey | MCTSXXWTWACOEZ-YNEHKIRRSA-N |
| XLogP | 2.32 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |