C23H26N2O2 — CID 10090048
8-(4,5-diphenylpyrazol-1-yl)octanoic acid (PubChem CID 10090048) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 8-(4,5-diphenylpyrazol-1-yl)octanoic acid.
| Compound Name | 8-(4,5-diphenylpyrazol-1-yl)octanoic acid |
|---|---|
| PubChem CID | 10090048 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 8-(4,5-diphenylpyrazol-1-yl)octanoic acid |
| SMILES | O=C(O)CCCCCCCn1ncc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2/c26-22(27)16-10-2-1-3-11-17-25-23(20-14-8-5-9-15-20)21(18-24-25)19-12-6-4-7-13-19/h4-9,12-15,18H,1-3,10-11,16-17H2,(H,26,27) |
| InChIKey | OLJBDKPTRLUCRA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|