C23H38O3 — CID 10090061
(3aS,4R,5R,7aR)-5,7-bis(cyclohexylmethyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol (PubChem CID 10090061) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (3aS,4R,5R,7aR)-5,7-bis(cyclohexylmethyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol.
| Compound Name | (3aS,4R,5R,7aR)-5,7-bis(cyclohexylmethyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
|---|---|
| PubChem CID | 10090061 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (3aS,4R,5R,7aR)-5,7-bis(cyclohexylmethyl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@H](CC3CCCCC3)C=C(CC3CCCCC3)[C@H]2O1 |
| InChI | InChI=1S/C23H38O3/c1-23(2)25-21-19(14-17-11-7-4-8-12-17)15-18(20(24)22(21)26-23)13-16-9-5-3-6-10-16/h15-18,20-22,24H,3-14H2,1-2H3/t18-,20-,21-,22+/m1/s1 |
| InChIKey | AQYSHESPSQLLJA-NMIHRBCNSA-N |
| XLogP | 5.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|