C16H25N5O3 — CID 100900773
(4S,5S)-7-[(2S)-3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione (PubChem CID 100900773) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is (4S,5S)-7-[(2S)-3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | (4S,5S)-7-[(2S)-3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 100900773 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (4S,5S)-7-[(2S)-3-[bis(prop-2-enyl)amino]-2-hydroxypropyl]-1,3-dimethyl-4,5-dihydropurine-2,6-dione |
| SMILES | C=CCN(CC=C)C[C@H](O)CN1C=N[C@@H]2[C@H]1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H25N5O3/c1-5-7-20(8-6-2)9-12(22)10-21-11-17-14-13(21)15(23)19(4)16(24)18(14)3/h5-6,11-14,22H,1-2,7-10H2,3-4H3/t12-,13-,14-/m0/s1 |
| InChIKey | HFNKCDPQPNEYJA-IHRRRGAJSA-N |
| XLogP | -0.42 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|