About (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one
(6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one (PubChem CID 100901327) has the molecular formula C17H17FOS2
and a molecular weight of 320.45 g/mol. Its IUPAC name is (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one.
Molecular Properties
| Compound Name | (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one |
| PubChem CID | 100901327 |
| Molecular Formula | C17H17FOS2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one |
| SMILES | O=C1C(=C2SCCCS2)CCC/C1=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FOS2/c18-14-7-5-12(6-8-14)11-13-3-1-4-15(16(13)19)17-20-9-2-10-21-17/h5-8,11H,1-4,9-10H2/b13-11- |
| InChIKey | IKXNLLJCZVWINM-QBFSEMIESA-N |
| XLogP | 5.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one?
The IUPAC name of (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one (CID 100901327) is (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one.
What is the SMILES notation for (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one?
The canonical SMILES for (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one is O=C1C(=C2SCCCS2)CCC/C1=C/c1ccc(F)cc1.
What is the InChIKey of (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one?
The InChIKey is IKXNLLJCZVWINM-QBFSEMIESA-N. The full InChI is InChI=1S/C17H17FOS2/c18-14-7-5-12(6-8-14)11-13-3-1-4-15(16(13)19)17-20-9-2-10-21-17/h5-8,11H,1-4,9-10H2/b13-11-.
What are the key properties of (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one?
(6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one has a molecular weight of 320.45 g/mol, XLogP of 5.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-2-(1,3-dithian-2-ylidene)-6-[(4-fluorophenyl)methylidene]cyclohexan-1-one is sourced from PubChem (CID 100901327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).