C15H25N3 — CID 100901496
(4aS,8aR)-1-[(1-ethylimidazol-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 100901496) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (4aS,8aR)-1-[(1-ethylimidazol-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | (4aS,8aR)-1-[(1-ethylimidazol-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 100901496 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (4aS,8aR)-1-[(1-ethylimidazol-2-yl)methyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | CCn1ccnc1CN1CCC[C@@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C15H25N3/c1-2-17-11-9-16-15(17)12-18-10-5-7-13-6-3-4-8-14(13)18/h9,11,13-14H,2-8,10,12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | AYNMZTFSKTWJBG-UONOGXRCSA-N |
| XLogP | 3.06 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |