C16H20BrN3O2 — CID 10090284
6-bromo-9-(3-methylbutyl)-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione (PubChem CID 10090284) has the molecular formula C16H20BrN3O2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 6-bromo-9-(3-methylbutyl)-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione.
| Compound Name | 6-bromo-9-(3-methylbutyl)-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10090284 |
| Molecular Formula | C16H20BrN3O2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 6-bromo-9-(3-methylbutyl)-4,7,8,10-tetrahydro-1H-pyrido[3,4-f]quinoxaline-2,3-dione |
| SMILES | CC(C)CCN1CCc2c(Br)cc3[nH]c(=O)c(=O)[nH]c3c2C1 |
| InChI | InChI=1S/C16H20BrN3O2/c1-9(2)3-5-20-6-4-10-11(8-20)14-13(7-12(10)17)18-15(21)16(22)19-14/h7,9H,3-6,8H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | NZJUQOAVHJUPHZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|