C16H32O5P2 — CID 10090298
[(7E)-1-[hydroxy(methyl)phosphoryl]-8,12-dimethyltrideca-7,11-dienyl]phosphonic acid (PubChem CID 10090298) has the molecular formula C16H32O5P2 and a molecular weight of 366.38 g/mol. Its IUPAC name is [(7E)-1-[hydroxy(methyl)phosphoryl]-8,12-dimethyltrideca-7,11-dienyl]phosphonic acid.
| Compound Name | [(7E)-1-[hydroxy(methyl)phosphoryl]-8,12-dimethyltrideca-7,11-dienyl]phosphonic acid |
|---|---|
| PubChem CID | 10090298 |
| Molecular Formula | C16H32O5P2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | [(7E)-1-[hydroxy(methyl)phosphoryl]-8,12-dimethyltrideca-7,11-dienyl]phosphonic acid |
| SMILES | CC(C)=CCC/C(C)=C/CCCCCC(P(C)(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C16H32O5P2/c1-14(2)10-9-12-15(3)11-7-5-6-8-13-16(22(4,17)18)23(19,20)21/h10-11,16H,5-9,12-13H2,1-4H3,(H,17,18)(H2,19,20,21)/b15-11+ |
| InChIKey | SGHSEOAKCTYRFU-RVDMUPIBSA-N |
| XLogP | 5.03 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|