About (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide
(2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide (PubChem CID 100903609) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide.
Molecular Properties
| Compound Name | (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide |
| PubChem CID | 100903609 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide |
| SMILES | NC(=O)[C@@H](c1ccccc1)N1CCO[C@@]2(CCc3ccccc32)C1 |
| InChI | InChI=1S/C20H22N2O2/c21-19(23)18(16-7-2-1-3-8-16)22-12-13-24-20(14-22)11-10-15-6-4-5-9-17(15)20/h1-9,18H,10-14H2,(H2,21,23)/t18-,20+/m1/s1 |
| InChIKey | VSZGBHZIAXNUEW-QUCCMNQESA-N |
| XLogP | 2.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide?
The IUPAC name of (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide (CID 100903609) is (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide.
What is the SMILES notation for (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide?
The canonical SMILES for (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide is NC(=O)[C@@H](c1ccccc1)N1CCO[C@@]2(CCc3ccccc32)C1.
What is the InChIKey of (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide?
The InChIKey is VSZGBHZIAXNUEW-QUCCMNQESA-N. The full InChI is InChI=1S/C20H22N2O2/c21-19(23)18(16-7-2-1-3-8-16)22-12-13-24-20(14-22)11-10-15-6-4-5-9-17(15)20/h1-9,18H,10-14H2,(H2,21,23)/t18-,20+/m1/s1.
What are the key properties of (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide?
(2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide has a molecular weight of 322.41 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-phenyl-2-[(3R)-spiro[1,2-dihydroindene-3,2'-morpholine]-4'-yl]acetamide is sourced from PubChem (CID 100903609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).