C16H20N2O3 — CID 100904524
N-(2-morpholin-4-ylphenyl)-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 100904524) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-(2-morpholin-4-ylphenyl)-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | N-(2-morpholin-4-ylphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 100904524 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(2-morpholin-4-ylphenyl)-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)C1=CCCCO1 |
| InChI | InChI=1S/C16H20N2O3/c19-16(15-7-3-4-10-21-15)17-13-5-1-2-6-14(13)18-8-11-20-12-9-18/h1-2,5-7H,3-4,8-12H2,(H,17,19) |
| InChIKey | SNCCAJXBYZGJCY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |