C19H25N5O — CID 100904923
(4aR,7aR)-4-methyl-6-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine (PubChem CID 100904923) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is (4aR,7aR)-4-methyl-6-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine.
| Compound Name | (4aR,7aR)-4-methyl-6-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 100904923 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | (4aR,7aR)-4-methyl-6-(3-pyrrolidin-1-ylquinoxalin-2-yl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine |
| SMILES | CN1CCO[C@@H]2CN(c3nc4ccccc4nc3N3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C19H25N5O/c1-22-10-11-25-17-13-24(12-16(17)22)19-18(23-8-4-5-9-23)20-14-6-2-3-7-15(14)21-19/h2-3,6-7,16-17H,4-5,8-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | NPMKTFYAOZWMTN-IAGOWNOFSA-N |
| XLogP | 1.75 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |