C15H25N3O2 — CID 100905127
(4aR,8aS)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 100905127) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is (4aR,8aS)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aR,8aS)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 100905127 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | (4aR,8aS)-4-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | CC(C)(C)c1nc(CN2CCO[C@H]3CCCC[C@H]32)no1 |
| InChI | InChI=1S/C15H25N3O2/c1-15(2,3)14-16-13(17-20-14)10-18-8-9-19-12-7-5-4-6-11(12)18/h11-12H,4-10H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | ZSJKYFHCKNSYIS-NEPJUHHUSA-N |
| XLogP | 2.51 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |