C25H38O2 — CID 10090584
3-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one (PubChem CID 10090584) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one.
| Compound Name | 3-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 10090584 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | 3-[(3E,7E,11E)-4,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C25H38O2/c1-20(2)10-6-11-21(3)12-7-13-22(4)14-8-15-23(5)16-9-17-24-18-25(26)27-19-24/h10,12,14,16,18H,6-9,11,13,15,17,19H2,1-5H3/b21-12+,22-14+,23-16+ |
| InChIKey | NSOLOFCWLXZPAF-MLAGYPMBSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|