C23H33NO3 — CID 10090630
(2E,6E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 10090630) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (2E,6E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 10090630 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (2E,6E)-N-[(4-hydroxy-3-methoxyphenyl)methyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | COc1cc(CNC(=O)/C=C(\C)CC/C=C(\C)CCC=C(C)C)ccc1O |
| InChI | InChI=1S/C23H33NO3/c1-17(2)8-6-9-18(3)10-7-11-19(4)14-23(26)24-16-20-12-13-21(25)22(15-20)27-5/h8,10,12-15,25H,6-7,9,11,16H2,1-5H3,(H,24,26)/b18-10+,19-14+ |
| InChIKey | MCXBWGHOXCXUTP-VBYAGUOWSA-N |
| XLogP | 5.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|