About 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid
1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid (PubChem CID 10090640) has the molecular formula C16H15F3N2O5
and a molecular weight of 372.30 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid.
Molecular Properties
| Compound Name | 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid |
| PubChem CID | 10090640 |
| Molecular Formula | C16H15F3N2O5 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid |
| SMILES | COC(Cn1c(-c2ccc(C(F)(F)F)cc2)ncc(C(=O)O)c1=O)OC |
| InChI | InChI=1S/C16H15F3N2O5/c1-25-12(26-2)8-21-13(20-7-11(14(21)22)15(23)24)9-3-5-10(6-4-9)16(17,18)19/h3-7,12H,8H2,1-2H3,(H,23,24) |
| InChIKey | WEDBJFDSNAOCSI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid?
The IUPAC name of 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid (CID 10090640) is 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid.
What is the SMILES notation for 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid?
The canonical SMILES for 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid is COC(Cn1c(-c2ccc(C(F)(F)F)cc2)ncc(C(=O)O)c1=O)OC.
What is the InChIKey of 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid?
The InChIKey is WEDBJFDSNAOCSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F3N2O5/c1-25-12(26-2)8-21-13(20-7-11(14(21)22)15(23)24)9-3-5-10(6-4-9)16(17,18)19/h3-7,12H,8H2,1-2H3,(H,23,24).
What are the key properties of 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid?
1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid has a molecular weight of 372.30 g/mol, XLogP of 2.25, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethoxyethyl)-6-oxo-2-[4-(trifluoromethyl)phenyl]pyrimidine-5-carboxylic acid is sourced from PubChem (CID 10090640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).