About N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine
N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine (PubChem CID 10090661) has the molecular formula C21H22F2N2O2
and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine.
Molecular Properties
| Compound Name | N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine |
| PubChem CID | 10090661 |
| Molecular Formula | C21H22F2N2O2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine |
| SMILES | Fc1cc2c(c(OCCNCCc3c[nH]c4ccc(F)cc34)c1)OCCC2 |
| InChI | InChI=1S/C21H22F2N2O2/c22-16-3-4-19-18(11-16)15(13-25-19)5-6-24-7-9-26-20-12-17(23)10-14-2-1-8-27-21(14)20/h3-4,10-13,24-25H,1-2,5-9H2 |
| InChIKey | DUTGEQMBAUMVEL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine?
The IUPAC name of N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine (CID 10090661) is N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine.
What is the SMILES notation for N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine?
The canonical SMILES for N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine is Fc1cc2c(c(OCCNCCc3c[nH]c4ccc(F)cc34)c1)OCCC2.
What is the InChIKey of N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine?
The InChIKey is DUTGEQMBAUMVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N2O2/c22-16-3-4-19-18(11-16)15(13-25-19)5-6-24-7-9-26-20-12-17(23)10-14-2-1-8-27-21(14)20/h3-4,10-13,24-25H,1-2,5-9H2.
What are the key properties of N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine?
N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine has a molecular weight of 372.42 g/mol, XLogP of 3.98, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(6-fluoro-3,4-dihydro-2H-chromen-8-yl)oxy]ethyl]-2-(5-fluoro-1H-indol-3-yl)ethanamine is sourced from PubChem (CID 10090661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).