C14H28N4O4S — CID 100906903
(2S)-N-(tert-butylcarbamoyl)-2-[(3R)-3-(sulfamoylmethyl)piperidin-1-yl]propanamide (PubChem CID 100906903) has the molecular formula C14H28N4O4S and a molecular weight of 348.47 g/mol. Its IUPAC name is (2S)-N-(tert-butylcarbamoyl)-2-[(3R)-3-(sulfamoylmethyl)piperidin-1-yl]propanamide.
| Compound Name | (2S)-N-(tert-butylcarbamoyl)-2-[(3R)-3-(sulfamoylmethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 100906903 |
| Molecular Formula | C14H28N4O4S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2S)-N-(tert-butylcarbamoyl)-2-[(3R)-3-(sulfamoylmethyl)piperidin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC(=O)NC(C)(C)C)N1CCC[C@@H](CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C14H28N4O4S/c1-10(12(19)16-13(20)17-14(2,3)4)18-7-5-6-11(8-18)9-23(15,21)22/h10-11H,5-9H2,1-4H3,(H2,15,21,22)(H2,16,17,19,20)/t10-,11+/m0/s1 |
| InChIKey | KVURKAGZRALJAP-WDEREUQCSA-N |
| XLogP | -0.00 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |