C28H23NS2 — CID 100907054
(2S,4S)-3-methyl-2,4-diphenylspiro[1,3-thiazolidine-5,9'-thioxanthene] (PubChem CID 100907054) has the molecular formula C28H23NS2 and a molecular weight of 437.63 g/mol. Its IUPAC name is (2S,4S)-3-methyl-2,4-diphenylspiro[1,3-thiazolidine-5,9'-thioxanthene].
| Compound Name | (2S,4S)-3-methyl-2,4-diphenylspiro[1,3-thiazolidine-5,9'-thioxanthene] |
|---|---|
| PubChem CID | 100907054 |
| Molecular Formula | C28H23NS2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (2S,4S)-3-methyl-2,4-diphenylspiro[1,3-thiazolidine-5,9'-thioxanthene] |
| SMILES | CN1[C@@H](c2ccccc2)C2(S[C@H]1c1ccccc1)c1ccccc1Sc1ccccc12 |
| InChI | InChI=1S/C28H23NS2/c1-29-26(20-12-4-2-5-13-20)28(31-27(29)21-14-6-3-7-15-21)22-16-8-10-18-24(22)30-25-19-11-9-17-23(25)28/h2-19,26-27H,1H3/t26-,27-/m0/s1 |
| InChIKey | RFLHEKITURKEQY-SVBPBHIXSA-N |
| XLogP | 7.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |