C22H35N3O2 — CID 10090759
7-(3-piperidin-1-ylpropoxy)-N-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine-2-carboxamide (PubChem CID 10090759) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 7-(3-piperidin-1-ylpropoxy)-N-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine-2-carboxamide.
| Compound Name | 7-(3-piperidin-1-ylpropoxy)-N-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine-2-carboxamide |
|---|---|
| PubChem CID | 10090759 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 7-(3-piperidin-1-ylpropoxy)-N-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepine-2-carboxamide |
| SMILES | CC(C)NC(=O)N1CCCc2cc(OCCCN3CCCCC3)ccc2C1 |
| InChI | InChI=1S/C22H35N3O2/c1-18(2)23-22(26)25-14-6-8-19-16-21(10-9-20(19)17-25)27-15-7-13-24-11-4-3-5-12-24/h9-10,16,18H,3-8,11-15,17H2,1-2H3,(H,23,26) |
| InChIKey | ZSWBEXROVVAQGI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|