C18H20I2N2 — CID 100908510
(2S,3R,4R)-2-ethyl-6-iodo-N-(4-iodophenyl)-3-methyl-1,2,3,4-tetrahydroquinolin-4-amine (PubChem CID 100908510) has the molecular formula C18H20I2N2 and a molecular weight of 518.18 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethyl-6-iodo-N-(4-iodophenyl)-3-methyl-1,2,3,4-tetrahydroquinolin-4-amine.
| Compound Name | (2S,3R,4R)-2-ethyl-6-iodo-N-(4-iodophenyl)-3-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 100908510 |
| Molecular Formula | C18H20I2N2 |
| Molecular Weight | 518.18 g/mol |
| Exact Mass | 517.97 |
| IUPAC Name | (2S,3R,4R)-2-ethyl-6-iodo-N-(4-iodophenyl)-3-methyl-1,2,3,4-tetrahydroquinolin-4-amine |
| SMILES | CC[C@@H]1Nc2ccc(I)cc2[C@H](Nc2ccc(I)cc2)[C@@H]1C |
| InChI | InChI=1S/C18H20I2N2/c1-3-16-11(2)18(21-14-7-4-12(19)5-8-14)15-10-13(20)6-9-17(15)22-16/h4-11,16,18,21-22H,3H2,1-2H3/t11-,16+,18-/m1/s1 |
| InChIKey | SDJSGMVBYLBKBG-DPZKZMLUSA-N |
| XLogP | 5.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.18 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|