About methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate
methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate (PubChem CID 10090924) has the molecular formula C21H16N2O5
and a molecular weight of 376.37 g/mol. Its IUPAC name is methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate |
| PubChem CID | 10090924 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1 |
| InChI | InChI=1S/C21H16N2O5/c1-25-21(24)17-8-7-16(28-17)20-14-9-18-19(27-12-26-18)10-15(14)23(22-20)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3 |
| InChIKey | UGOGUHHVLPRDKE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate?
The IUPAC name of methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate (CID 10090924) is methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate.
What is the SMILES notation for methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate?
The canonical SMILES for methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate is COC(=O)c1ccc(-c2nn(Cc3ccccc3)c3cc4c(cc23)OCO4)o1.
What is the InChIKey of methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate?
The InChIKey is UGOGUHHVLPRDKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N2O5/c1-25-21(24)17-8-7-16(28-17)20-14-9-18-19(27-12-26-18)10-15(14)23(22-20)11-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3.
What are the key properties of methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate?
methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate has a molecular weight of 376.37 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1-benzyl-[1,3]dioxolo[4,5-f]indazol-3-yl)furan-2-carboxylate is sourced from PubChem (CID 10090924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).