C21H25ClO4 — CID 10090974
(3Z,3aR,4R,6aR)-3-[(3-chlorophenyl)methylidene]-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 10090974) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is (3Z,3aR,4R,6aR)-3-[(3-chlorophenyl)methylidene]-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3Z,3aR,4R,6aR)-3-[(3-chlorophenyl)methylidene]-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 10090974 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (3Z,3aR,4R,6aR)-3-[(3-chlorophenyl)methylidene]-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | CCCCCCCC[C@H]1OC(=O)[C@@H]2OC(=O)/C(=C\c3cccc(Cl)c3)[C@H]12 |
| InChI | InChI=1S/C21H25ClO4/c1-2-3-4-5-6-7-11-17-18-16(13-14-9-8-10-15(22)12-14)20(23)26-19(18)21(24)25-17/h8-10,12-13,17-19H,2-7,11H2,1H3/b16-13-/t17-,18-,19-/m1/s1 |
| InChIKey | VKQMIQBXSCUHBA-GDXCSNOMSA-N |
| XLogP | 4.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|