C19H25N3O2 — CID 100909807
2-[[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]-benzylamino]acetonitrile (PubChem CID 100909807) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]-benzylamino]acetonitrile.
| Compound Name | 2-[[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]-benzylamino]acetonitrile |
|---|---|
| PubChem CID | 100909807 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 2-[[2-[(4aR,8aR)-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl]-2-oxoethyl]-benzylamino]acetonitrile |
| SMILES | N#CCN(CC(=O)N1CCO[C@@H]2CCCC[C@H]21)Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O2/c20-10-11-21(14-16-6-2-1-3-7-16)15-19(23)22-12-13-24-18-9-5-4-8-17(18)22/h1-3,6-7,17-18H,4-5,8-9,11-15H2/t17-,18-/m1/s1 |
| InChIKey | GNLXTPXOQBHTDM-QZTJIDSGSA-N |
| XLogP | 2.18 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|