C15H20N2 — CID 100910771
1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methyl-N-(pyridin-4-ylmethyl)methanamine (PubChem CID 100910771) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methyl-N-(pyridin-4-ylmethyl)methanamine.
| Compound Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methyl-N-(pyridin-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 100910771 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 1-[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-N-methyl-N-(pyridin-4-ylmethyl)methanamine |
| SMILES | CN(Cc1ccncc1)C[C@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C15H20N2/c1-17(10-12-4-6-16-7-5-12)11-15-9-13-2-3-14(15)8-13/h2-7,13-15H,8-11H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | LXCWWATXIHYESU-SOUVJXGZSA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|