C31H24N2O2 — CID 100910918
2-[(1S,2S,6S,7S)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile (PubChem CID 100910918) has the molecular formula C31H24N2O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[(1S,2S,6S,7S)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile.
| Compound Name | 2-[(1S,2S,6S,7S)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
|---|---|
| PubChem CID | 100910918 |
| Molecular Formula | C31H24N2O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 2-[(1S,2S,6S,7S)-10-[bis(4-methylphenyl)methylidene]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzonitrile |
| SMILES | Cc1ccc(C(=C2[C@H]3C=C[C@H]2[C@@H]2C(=O)N(c4ccccc4C#N)C(=O)[C@H]23)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H24N2O2/c1-18-7-11-20(12-8-18)26(21-13-9-19(2)10-14-21)27-23-15-16-24(27)29-28(23)30(34)33(31(29)35)25-6-4-3-5-22(25)17-32/h3-16,23-24,28-29H,1-2H3/t23-,24-,28+,29+/m1/s1 |
| InChIKey | FCNDCUMJXZKEIM-YQHHHJOQSA-N |
| XLogP | 5.60 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|