C13H15Cl3O3 — CID 100910946
(2S,4S)-2-(4-chlorophenyl)-4-[[(2R)-2,3-dichloropropoxy]methyl]-1,3-dioxolane (PubChem CID 100910946) has the molecular formula C13H15Cl3O3 and a molecular weight of 325.62 g/mol. Its IUPAC name is (2S,4S)-2-(4-chlorophenyl)-4-[[(2R)-2,3-dichloropropoxy]methyl]-1,3-dioxolane.
| Compound Name | (2S,4S)-2-(4-chlorophenyl)-4-[[(2R)-2,3-dichloropropoxy]methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 100910946 |
| Molecular Formula | C13H15Cl3O3 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (2S,4S)-2-(4-chlorophenyl)-4-[[(2R)-2,3-dichloropropoxy]methyl]-1,3-dioxolane |
| SMILES | ClC[C@H](Cl)COC[C@H]1CO[C@H](c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C13H15Cl3O3/c14-5-11(16)6-17-7-12-8-18-13(19-12)9-1-3-10(15)4-2-9/h1-4,11-13H,5-8H2/t11-,12-,13-/m0/s1 |
| InChIKey | CKAGUBYMMHRUIZ-AVGNSLFASA-N |
| XLogP | 3.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|