About 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine
2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine (PubChem CID 10091129) has the molecular formula C27H25NO
and a molecular weight of 379.50 g/mol. Its IUPAC name is 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine |
| PubChem CID | 10091129 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine |
| SMILES | CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Oc4ccccc4)cc3)cn2C1 |
| InChI | InChI=1S/C27H25NO/c1-27(2)17-25-26(21-9-5-3-6-10-21)24(18-28(25)19-27)20-13-15-23(16-14-20)29-22-11-7-4-8-12-22/h3-16,18H,17,19H2,1-2H3 |
| InChIKey | LZFWXBAHWAIELL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine?
The IUPAC name of 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine (CID 10091129) is 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine.
What is the SMILES notation for 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine?
The canonical SMILES for 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine is CC1(C)Cc2c(-c3ccccc3)c(-c3ccc(Oc4ccccc4)cc3)cn2C1.
What is the InChIKey of 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine?
The InChIKey is LZFWXBAHWAIELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25NO/c1-27(2)17-25-26(21-9-5-3-6-10-21)24(18-28(25)19-27)20-13-15-23(16-14-20)29-22-11-7-4-8-12-22/h3-16,18H,17,19H2,1-2H3.
What are the key properties of 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine?
2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine has a molecular weight of 379.50 g/mol, XLogP of 7.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(4-phenoxyphenyl)-7-phenyl-1,3-dihydropyrrolizine is sourced from PubChem (CID 10091129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).