C21H24N4OS — CID 10091184
(E)-1-(2-ethylpiperidin-1-yl)-3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)prop-2-en-1-one (PubChem CID 10091184) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is (E)-1-(2-ethylpiperidin-1-yl)-3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-ethylpiperidin-1-yl)-3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10091184 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (E)-1-(2-ethylpiperidin-1-yl)-3-(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)prop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)/C=C/c1c(-c2ccccc2)nc2sc(C)nn12 |
| InChI | InChI=1S/C21H24N4OS/c1-3-17-11-7-8-14-24(17)19(26)13-12-18-20(16-9-5-4-6-10-16)22-21-25(18)23-15(2)27-21/h4-6,9-10,12-13,17H,3,7-8,11,14H2,1-2H3/b13-12+ |
| InChIKey | MAHZBQKDIVMHII-OUKQBFOZSA-N |
| XLogP | 4.57 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|