About 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 10091185) has the molecular formula C20H24N6S
and a molecular weight of 380.52 g/mol. Its IUPAC name is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| PubChem CID | 10091185 |
| Molecular Formula | C20H24N6S |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | Cc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)s1 |
| InChI | InChI=1S/C20H24N6S/c1-14-19(27-15(2)22-14)18-8-9-21-20(24-18)23-16-4-6-17(7-5-16)26-12-10-25(3)11-13-26/h4-9H,10-13H2,1-3H3,(H,21,23,24) |
| InChIKey | DGNOUZUYIKVFRZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine?
The IUPAC name of 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (CID 10091185) is 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
What is the SMILES notation for 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine?
The canonical SMILES for 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine is Cc1nc(C)c(-c2ccnc(Nc3ccc(N4CCN(C)CC4)cc3)n2)s1.
What is the InChIKey of 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine?
The InChIKey is DGNOUZUYIKVFRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6S/c1-14-19(27-15(2)22-14)18-8-9-21-20(24-18)23-16-4-6-17(7-5-16)26-12-10-25(3)11-13-26/h4-9H,10-13H2,1-3H3,(H,21,23,24).
What are the key properties of 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine?
4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine has a molecular weight of 380.52 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine is sourced from PubChem (CID 10091185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).