About 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine
3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine (PubChem CID 10091305) has the molecular formula C18H14N4O2S2
and a molecular weight of 382.47 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine |
| PubChem CID | 10091305 |
| Molecular Formula | C18H14N4O2S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine |
| SMILES | [H]/N=c1/c(S(=O)(=O)c2ccccc2)c(SC)nc2c3ncccc3ccn12 |
| InChI | InChI=1S/C18H14N4O2S2/c1-25-18-15(26(23,24)13-7-3-2-4-8-13)16(19)22-11-9-12-6-5-10-20-14(12)17(22)21-18/h2-11,19H,1H3/b19-16- |
| InChIKey | FZNQPDUVUCXVBY-MNDPQUGUSA-N |
| XLogP | 2.92 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine?
The IUPAC name of 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine (CID 10091305) is 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine.
What is the SMILES notation for 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine?
The canonical SMILES for 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine is [H]/N=c1/c(S(=O)(=O)c2ccccc2)c(SC)nc2c3ncccc3ccn12.
What is the InChIKey of 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine?
The InChIKey is FZNQPDUVUCXVBY-MNDPQUGUSA-N. The full InChI is InChI=1S/C18H14N4O2S2/c1-25-18-15(26(23,24)13-7-3-2-4-8-13)16(19)22-11-9-12-6-5-10-20-14(12)17(22)21-18/h2-11,19H,1H3/b19-16-.
What are the key properties of 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine?
3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine has a molecular weight of 382.47 g/mol, XLogP of 2.92, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-2-methylsulfanylpyrimido[1,2-h][1,7]naphthyridin-4-imine is sourced from PubChem (CID 10091305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).