C20H38O3Si2 — CID 10091330
(3aS,5R,6S,6aR)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one (PubChem CID 10091330) has the molecular formula C20H38O3Si2 and a molecular weight of 382.69 g/mol. Its IUPAC name is (3aS,5R,6S,6aR)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one.
| Compound Name | (3aS,5R,6S,6aR)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
|---|---|
| PubChem CID | 10091330 |
| Molecular Formula | C20H38O3Si2 |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | (3aS,5R,6S,6aR)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5,6,6a-tetrahydro-3aH-pentalen-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@@H]2C(=O)C=C[C@@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O3Si2/c1-19(2,3)24(7,8)22-16-13-14-11-12-15(21)17(14)18(16)23-25(9,10)20(4,5)6/h11-12,14,16-18H,13H2,1-10H3/t14-,16-,17+,18-/m1/s1 |
| InChIKey | KMCJJBVWIFRXIE-NRSFXHEJSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|