About 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride
5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (PubChem CID 10091339) has the molecular formula C22H23ClN2O2
and a molecular weight of 382.89 g/mol. Its IUPAC name is 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
Molecular Properties
| Compound Name | 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| PubChem CID | 10091339 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| SMILES | Cc1cc[n+](CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)n1C.[Cl-] |
| InChI | InChI=1S/C22H23N2O2.ClH/c1-17-13-14-24(23(17)2)16-20-15-22(21(25)26-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-14,20H,15-16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YTDKIEFQRPSETL-UHFFFAOYSA-M |
| XLogP | -0.07 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The IUPAC name of 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (CID 10091339) is 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
What is the SMILES notation for 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The canonical SMILES for 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is Cc1cc[n+](CC2CC(c3ccccc3)(c3ccccc3)C(=O)O2)n1C.[Cl-].
What is the InChIKey of 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The InChIKey is YTDKIEFQRPSETL-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H23N2O2.ClH/c1-17-13-14-24(23(17)2)16-20-15-22(21(25)26-20,18-9-5-3-6-10-18)19-11-7-4-8-12-19;/h3-14,20H,15-16H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride has a molecular weight of 382.89 g/mol, XLogP of -0.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,3-dimethylpyrazol-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is sourced from PubChem (CID 10091339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).