C19H30O3 — CID 100913703
(3E,4S,5R)-4-hydroxy-5-methyl-3-[(11E)-tetradeca-11,13-dienylidene]oxolan-2-one (PubChem CID 100913703) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3E,4S,5R)-4-hydroxy-5-methyl-3-[(11E)-tetradeca-11,13-dienylidene]oxolan-2-one.
| Compound Name | (3E,4S,5R)-4-hydroxy-5-methyl-3-[(11E)-tetradeca-11,13-dienylidene]oxolan-2-one |
|---|---|
| PubChem CID | 100913703 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3E,4S,5R)-4-hydroxy-5-methyl-3-[(11E)-tetradeca-11,13-dienylidene]oxolan-2-one |
| SMILES | C=C/C=C/CCCCCCCCC/C=C1/C(=O)O[C@H](C)[C@H]1O |
| InChI | InChI=1S/C19H30O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(20)16(2)22-19(17)21/h3-5,15-16,18,20H,1,6-14H2,2H3/b5-4+,17-15+/t16-,18-/m1/s1 |
| InChIKey | TYHMSLNZHHZCSR-AUWBBPBRSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|